C10H15BN4O3S — CID 174101878
CID 174101878 (PubChem CID 174101878) has the molecular formula C10H15BN4O3S and a molecular weight of 282.13 g/mol.
| Compound Name | CID 174101878 |
|---|---|
| PubChem CID | 174101878 |
| Molecular Formula | C10H15BN4O3S |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | — |
| SMILES | [B]c1cn(C)c(=O)c(N2CCN(S(C)(=O)=O)CC2)n1 |
| InChI | InChI=1S/C10H15BN4O3S/c1-13-7-8(11)12-9(10(13)16)14-3-5-15(6-4-14)19(2,17)18/h7H,3-6H2,1-2H3 |
| InChIKey | MVAPMMPSMHBMJY-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|