C23H21N3O4 — CID 146247964
7-(2,1-benzoxazol-3-yl)-6-methyl-4-[(1-prop-2-enoylazetidin-3-yl)methyl]-1,4-benzoxazin-3-one (PubChem CID 146247964) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is 7-(2,1-benzoxazol-3-yl)-6-methyl-4-[(1-prop-2-enoylazetidin-3-yl)methyl]-1,4-benzoxazin-3-one.
| Compound Name | 7-(2,1-benzoxazol-3-yl)-6-methyl-4-[(1-prop-2-enoylazetidin-3-yl)methyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 146247964 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 7-(2,1-benzoxazol-3-yl)-6-methyl-4-[(1-prop-2-enoylazetidin-3-yl)methyl]-1,4-benzoxazin-3-one |
| SMILES | C=CC(=O)N1CC(CN2C(=O)COc3cc(-c4onc5ccccc45)c(C)cc32)C1 |
| InChI | InChI=1S/C23H21N3O4/c1-3-21(27)25-10-15(11-25)12-26-19-8-14(2)17(9-20(19)29-13-22(26)28)23-16-6-4-5-7-18(16)24-30-23/h3-9,15H,1,10-13H2,2H3 |
| InChIKey | BCCXYZAGXKXZGQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|