C25H29ClN4O3 — CID 153362379
6-chloro-7-ethenyl-4-[(1-prop-2-enoylazetidin-3-yl)methyl]-1,4-benzoxazin-3-one;5-[(Z)-pent-2-enyl]-1H-pyrazole (PubChem CID 153362379) has the molecular formula C25H29ClN4O3 and a molecular weight of 468.99 g/mol. Its IUPAC name is 6-chloro-7-ethenyl-4-[(1-prop-2-enoylazetidin-3-yl)methyl]-1,4-benzoxazin-3-one;5-[(Z)-pent-2-enyl]-1H-pyrazole.
| Compound Name | 6-chloro-7-ethenyl-4-[(1-prop-2-enoylazetidin-3-yl)methyl]-1,4-benzoxazin-3-one;5-[(Z)-pent-2-enyl]-1H-pyrazole |
|---|---|
| PubChem CID | 153362379 |
| Molecular Formula | C25H29ClN4O3 |
| Molecular Weight | 468.99 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 6-chloro-7-ethenyl-4-[(1-prop-2-enoylazetidin-3-yl)methyl]-1,4-benzoxazin-3-one;5-[(Z)-pent-2-enyl]-1H-pyrazole |
| SMILES | C=CC(=O)N1CC(CN2C(=O)COc3cc(C=C)c(Cl)cc32)C1.CC/C=C\Cc1ccn[nH]1 |
| InChI | InChI=1S/C17H17ClN2O3.C8H12N2/c1-3-12-5-15-14(6-13(12)18)20(17(22)10-23-15)9-11-7-19(8-11)16(21)4-2;1-2-3-4-5-8-6-7-9-10-8/h3-6,11H,1-2,7-10H2;3-4,6-7H,2,5H2,1H3,(H,9,10)/b;4-3- |
| InChIKey | IBHVXUJULUUOMW-QGAMPUOQSA-N |
| XLogP | 4.27 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.99 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|