C16H15FN4O2S — CID 14624839
N-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-4,5-dihydro-3H-pyridazine-2-carbothioamide (PubChem CID 14624839) has the molecular formula C16H15FN4O2S and a molecular weight of 346.39 g/mol. Its IUPAC name is N-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-4,5-dihydro-3H-pyridazine-2-carbothioamide.
| Compound Name | N-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-4,5-dihydro-3H-pyridazine-2-carbothioamide |
|---|---|
| PubChem CID | 14624839 |
| Molecular Formula | C16H15FN4O2S |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-4,5-dihydro-3H-pyridazine-2-carbothioamide |
| SMILES | C#CCN1C(=O)COc2cc(F)c(NC(=S)N3CCCC=N3)cc21 |
| InChI | InChI=1S/C16H15FN4O2S/c1-2-6-20-13-9-12(11(17)8-14(13)23-10-15(20)22)19-16(24)21-7-4-3-5-18-21/h1,5,8-9H,3-4,6-7,10H2,(H,19,24) |
| InChIKey | XFPAEBJJEKSBND-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|