C54H96Br2O26 — CID 146249208
bis[2-[2-[2-[2-[2-[2-[2-[5-[2-(2-hydroperoxyethoxy)ethoxy]pentoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 2,5-dibromobenzene-1,4-dicarboxylate (PubChem CID 146249208) has the molecular formula C54H96Br2O26 and a molecular weight of 1321.14 g/mol. Its IUPAC name is bis[2-[2-[2-[2-[2-[2-[2-[5-[2-(2-hydroperoxyethoxy)ethoxy]pentoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 2,5-dibromobenzene-1,4-dicarboxylate.
| Compound Name | bis[2-[2-[2-[2-[2-[2-[2-[5-[2-(2-hydroperoxyethoxy)ethoxy]pentoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 2,5-dibromobenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 146249208 |
| Molecular Formula | C54H96Br2O26 |
| Molecular Weight | 1321.14 g/mol |
| Exact Mass | 1318.46 |
| IUPAC Name | bis[2-[2-[2-[2-[2-[2-[2-[5-[2-(2-hydroperoxyethoxy)ethoxy]pentoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl] 2,5-dibromobenzene-1,4-dicarboxylate |
| SMILES | O=C(OCCOCCOCCOCCOCCOCCOCCOCCCCCOCCOCCOO)c1cc(Br)c(C(=O)OCCOCCOCCOCCOCCOCCOCCOCCCCCOCCOCCOO)cc1Br |
| InChI | InChI=1S/C54H96Br2O26/c55-51-48-50(54(58)80-44-40-76-38-36-74-34-32-72-30-28-70-26-24-68-22-20-66-16-12-62-8-4-2-6-10-64-14-18-78-42-46-82-60)52(56)47-49(51)53(57)79-43-39-75-37-35-73-33-31-71-29-27-69-25-23-67-21-19-65-15-11-61-7-3-1-5-9-63-13-17-77-41-45-81-59/h47-48,59-60H,1-46H2 |
| InChIKey | YHBDUKQBHHKYAY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 277.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 26 |
| Rotatable Bonds | 68 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1321.14 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 26 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|