C23H24F2N2O — CID 146249225
N-(2,4-dimethyl-1-phenylpentan-2-yl)-2,3-difluoroquinoline-8-carboxamide (PubChem CID 146249225) has the molecular formula C23H24F2N2O and a molecular weight of 382.45 g/mol. Its IUPAC name is N-(2,4-dimethyl-1-phenylpentan-2-yl)-2,3-difluoroquinoline-8-carboxamide.
| Compound Name | N-(2,4-dimethyl-1-phenylpentan-2-yl)-2,3-difluoroquinoline-8-carboxamide |
|---|---|
| PubChem CID | 146249225 |
| Molecular Formula | C23H24F2N2O |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-(2,4-dimethyl-1-phenylpentan-2-yl)-2,3-difluoroquinoline-8-carboxamide |
| SMILES | CC(C)CC(C)(Cc1ccccc1)NC(=O)c1cccc2cc(F)c(F)nc12 |
| InChI | InChI=1S/C23H24F2N2O/c1-15(2)13-23(3,14-16-8-5-4-6-9-16)27-22(28)18-11-7-10-17-12-19(24)21(25)26-20(17)18/h4-12,15H,13-14H2,1-3H3,(H,27,28) |
| InChIKey | UDNYBIPGOCAHMP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|