C16H18BrFN4OS — CID 146251974
5-bromo-1-[(4-fluorophenyl)methyl]-3-(4-methylsulfanylpiperazin-1-yl)pyrazin-2-one (PubChem CID 146251974) has the molecular formula C16H18BrFN4OS and a molecular weight of 413.32 g/mol. Its IUPAC name is 5-bromo-1-[(4-fluorophenyl)methyl]-3-(4-methylsulfanylpiperazin-1-yl)pyrazin-2-one.
| Compound Name | 5-bromo-1-[(4-fluorophenyl)methyl]-3-(4-methylsulfanylpiperazin-1-yl)pyrazin-2-one |
|---|---|
| PubChem CID | 146251974 |
| Molecular Formula | C16H18BrFN4OS |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 5-bromo-1-[(4-fluorophenyl)methyl]-3-(4-methylsulfanylpiperazin-1-yl)pyrazin-2-one |
| SMILES | CSN1CCN(c2nc(Br)cn(Cc3ccc(F)cc3)c2=O)CC1 |
| InChI | InChI=1S/C16H18BrFN4OS/c1-24-22-8-6-20(7-9-22)15-16(23)21(11-14(17)19-15)10-12-2-4-13(18)5-3-12/h2-5,11H,6-10H2,1H3 |
| InChIKey | XHLBJXFQWRJUEA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|