C15H15BrFN3OS — CID 146251975
5-bromo-1-[(4-fluorophenyl)methyl]-3-thiomorpholin-4-ylpyrazin-2-one (PubChem CID 146251975) has the molecular formula C15H15BrFN3OS and a molecular weight of 384.27 g/mol. Its IUPAC name is 5-bromo-1-[(4-fluorophenyl)methyl]-3-thiomorpholin-4-ylpyrazin-2-one.
| Compound Name | 5-bromo-1-[(4-fluorophenyl)methyl]-3-thiomorpholin-4-ylpyrazin-2-one |
|---|---|
| PubChem CID | 146251975 |
| Molecular Formula | C15H15BrFN3OS |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | 5-bromo-1-[(4-fluorophenyl)methyl]-3-thiomorpholin-4-ylpyrazin-2-one |
| SMILES | O=c1c(N2CCSCC2)nc(Br)cn1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H15BrFN3OS/c16-13-10-20(9-11-1-3-12(17)4-2-11)15(21)14(18-13)19-5-7-22-8-6-19/h1-4,10H,5-9H2 |
| InChIKey | PYCNRBOKLWVGHT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |