C9H11N3S — CID 146253423
7-N-ethylthieno[3,2-b]pyridine-6,7-diamine (PubChem CID 146253423) has the molecular formula C9H11N3S and a molecular weight of 193.28 g/mol. Its IUPAC name is 7-N-ethylthieno[3,2-b]pyridine-6,7-diamine.
| Compound Name | 7-N-ethylthieno[3,2-b]pyridine-6,7-diamine |
|---|---|
| PubChem CID | 146253423 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.28 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 7-N-ethylthieno[3,2-b]pyridine-6,7-diamine |
| SMILES | CCNc1c(N)cnc2ccsc12 |
| InChI | InChI=1S/C9H11N3S/c1-2-11-8-6(10)5-12-7-3-4-13-9(7)8/h3-5H,2,10H2,1H3,(H,11,12) |
| InChIKey | QAPQMQSOUAJGFA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |