C19H21FN2O5S — CID 146255968
N-(4-fluorophenyl)-5-[[(1R,3S)-3-hydroxycyclopentyl]sulfamoyl]-2-methoxybenzamide (PubChem CID 146255968) has the molecular formula C19H21FN2O5S and a molecular weight of 408.45 g/mol. Its IUPAC name is N-(4-fluorophenyl)-5-[[(1R,3S)-3-hydroxycyclopentyl]sulfamoyl]-2-methoxybenzamide.
| Compound Name | N-(4-fluorophenyl)-5-[[(1R,3S)-3-hydroxycyclopentyl]sulfamoyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 146255968 |
| Molecular Formula | C19H21FN2O5S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N-(4-fluorophenyl)-5-[[(1R,3S)-3-hydroxycyclopentyl]sulfamoyl]-2-methoxybenzamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H]2CC[C@H](O)C2)cc1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H21FN2O5S/c1-27-18-9-8-16(28(25,26)22-14-6-7-15(23)10-14)11-17(18)19(24)21-13-4-2-12(20)3-5-13/h2-5,8-9,11,14-15,22-23H,6-7,10H2,1H3,(H,21,24)/t14-,15+/m1/s1 |
| InChIKey | VAGOPXFAGVQFOE-CABCVRRESA-N |
| XLogP | 2.28 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |