C18H18ClFN2O5S — CID 146237146
N-(4-chloro-2-fluorophenyl)-5-[(3-hydroxycyclobutyl)sulfamoyl]-2-methoxybenzamide (PubChem CID 146237146) has the molecular formula C18H18ClFN2O5S and a molecular weight of 428.87 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-5-[(3-hydroxycyclobutyl)sulfamoyl]-2-methoxybenzamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-5-[(3-hydroxycyclobutyl)sulfamoyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 146237146 |
| Molecular Formula | C18H18ClFN2O5S |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-5-[(3-hydroxycyclobutyl)sulfamoyl]-2-methoxybenzamide |
| SMILES | COc1ccc(S(=O)(=O)NC2CC(O)C2)cc1C(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C18H18ClFN2O5S/c1-27-17-5-3-13(28(25,26)22-11-7-12(23)8-11)9-14(17)18(24)21-16-4-2-10(19)6-15(16)20/h2-6,9,11-12,22-23H,7-8H2,1H3,(H,21,24) |
| InChIKey | LVJDWHPERQLWBJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |