C21H17F8NO2S — CID 146257126
(3aR,9bR)-9b-(benzenesulfonyl)-8-fluoro-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole (PubChem CID 146257126) has the molecular formula C21H17F8NO2S and a molecular weight of 499.42 g/mol. Its IUPAC name is (3aR,9bR)-9b-(benzenesulfonyl)-8-fluoro-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole.
| Compound Name | (3aR,9bR)-9b-(benzenesulfonyl)-8-fluoro-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
|---|---|
| PubChem CID | 146257126 |
| Molecular Formula | C21H17F8NO2S |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | (3aR,9bR)-9b-(benzenesulfonyl)-8-fluoro-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
| SMILES | O=S(=O)(c1ccccc1)[C@@]12CCN[C@@H]1CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)c(F)cc12 |
| InChI | InChI=1S/C21H17F8NO2S/c22-16-11-14-12(10-15(16)19(23,20(24,25)26)21(27,28)29)6-7-17-18(14,8-9-30-17)33(31,32)13-4-2-1-3-5-13/h1-5,10-11,17,30H,6-9H2/t17-,18-/m1/s1 |
| InChIKey | WVEYESFTYKLPLA-QZTJIDSGSA-N |
| XLogP | 5.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |