C22H16F8N2O2S — CID 122669246
(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonitrile (PubChem CID 122669246) has the molecular formula C22H16F8N2O2S and a molecular weight of 524.43 g/mol. Its IUPAC name is (3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonitrile.
| Compound Name | (3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonitrile |
|---|---|
| PubChem CID | 122669246 |
| Molecular Formula | C22H16F8N2O2S |
| Molecular Weight | 524.43 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | (3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonitrile |
| SMILES | N#CN1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C22H16F8N2O2S/c23-15-3-5-16(6-4-15)35(33,34)19-9-10-32(12-31)18(19)8-1-13-11-14(2-7-17(13)19)20(24,21(25,26)27)22(28,29)30/h2-7,11,18H,1,8-10H2/t18-,19-/m1/s1 |
| InChIKey | BCMPTGHPPKHMIV-RTBURBONSA-N |
| XLogP | 5.29 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|