C24H22F8N2O3S — CID 122669211
(3aR,9bR)-N-ethyl-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxamide (PubChem CID 122669211) has the molecular formula C24H22F8N2O3S and a molecular weight of 570.50 g/mol. Its IUPAC name is (3aR,9bR)-N-ethyl-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxamide.
| Compound Name | (3aR,9bR)-N-ethyl-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxamide |
|---|---|
| PubChem CID | 122669211 |
| Molecular Formula | C24H22F8N2O3S |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | (3aR,9bR)-N-ethyl-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxamide |
| SMILES | CCNC(=O)N1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C24H22F8N2O3S/c1-2-33-20(35)34-12-11-21(38(36,37)17-7-5-16(25)6-8-17)18-9-4-15(13-14(18)3-10-19(21)34)22(26,23(27,28)29)24(30,31)32/h4-9,13,19H,2-3,10-12H2,1H3,(H,33,35)/t19-,21-/m1/s1 |
| InChIKey | LKBKHFSEJYFWRW-TZIWHRDSSA-N |
| XLogP | 5.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |