C20H28F3N7S — CID 146258844
2-N-(4,4-difluorocyclohexyl)-4-N-(4-fluoro-4-methylcyclohexyl)-6-(3-methyl-6H-1,2,4-thiadiazin-5-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 146258844) has the molecular formula C20H28F3N7S and a molecular weight of 455.55 g/mol. Its IUPAC name is 2-N-(4,4-difluorocyclohexyl)-4-N-(4-fluoro-4-methylcyclohexyl)-6-(3-methyl-6H-1,2,4-thiadiazin-5-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4,4-difluorocyclohexyl)-4-N-(4-fluoro-4-methylcyclohexyl)-6-(3-methyl-6H-1,2,4-thiadiazin-5-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 146258844 |
| Molecular Formula | C20H28F3N7S |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 2-N-(4,4-difluorocyclohexyl)-4-N-(4-fluoro-4-methylcyclohexyl)-6-(3-methyl-6H-1,2,4-thiadiazin-5-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC1=NSCC(c2nc(NC3CCC(C)(F)CC3)nc(NC3CCC(F)(F)CC3)n2)=N1 |
| InChI | InChI=1S/C20H28F3N7S/c1-12-24-15(11-31-30-12)16-27-17(25-13-3-7-19(2,21)8-4-13)29-18(28-16)26-14-5-9-20(22,23)10-6-14/h13-14H,3-11H2,1-2H3,(H2,25,26,27,28,29) |
| InChIKey | DEKZUWUAJCQMGS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|