C18H22ClN3 — CID 146280004
1-(3-benzyl-5-chloro-4-pyridinyl)-4-methyl-1,4-diazepane (PubChem CID 146280004) has the molecular formula C18H22ClN3 and a molecular weight of 315.85 g/mol. Its IUPAC name is 1-(3-benzyl-5-chloro-4-pyridinyl)-4-methyl-1,4-diazepane.
| Compound Name | 1-(3-benzyl-5-chloro-4-pyridinyl)-4-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 146280004 |
| Molecular Formula | C18H22ClN3 |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-(3-benzyl-5-chloro-4-pyridinyl)-4-methyl-1,4-diazepane |
| SMILES | CN1CCCN(c2c(Cl)cncc2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H22ClN3/c1-21-8-5-9-22(11-10-21)18-16(13-20-14-17(18)19)12-15-6-3-2-4-7-15/h2-4,6-7,13-14H,5,8-12H2,1H3 |
| InChIKey | UDFXGYSGDOZGJK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |