C28H42N2O3 — CID 146282335
3-[2-[[ethyl(propyl)amino]methyl]-5-methoxyphenoxy]-N-[(4-pentylphenyl)methyl]propanamide (PubChem CID 146282335) has the molecular formula C28H42N2O3 and a molecular weight of 454.66 g/mol. Its IUPAC name is 3-[2-[[ethyl(propyl)amino]methyl]-5-methoxyphenoxy]-N-[(4-pentylphenyl)methyl]propanamide.
| Compound Name | 3-[2-[[ethyl(propyl)amino]methyl]-5-methoxyphenoxy]-N-[(4-pentylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 146282335 |
| Molecular Formula | C28H42N2O3 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.32 |
| IUPAC Name | 3-[2-[[ethyl(propyl)amino]methyl]-5-methoxyphenoxy]-N-[(4-pentylphenyl)methyl]propanamide |
| SMILES | CCCCCc1ccc(CNC(=O)CCOc2cc(OC)ccc2CN(CC)CCC)cc1 |
| InChI | InChI=1S/C28H42N2O3/c1-5-8-9-10-23-11-13-24(14-12-23)21-29-28(31)17-19-33-27-20-26(32-4)16-15-25(27)22-30(7-3)18-6-2/h11-16,20H,5-10,17-19,21-22H2,1-4H3,(H,29,31) |
| InChIKey | RCNPNDLAVFZKGZ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|