C9H4ClF3N2O2 — CID 146289561
2-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-cyanoacetic acid (PubChem CID 146289561) has the molecular formula C9H4ClF3N2O2 and a molecular weight of 264.59 g/mol. Its IUPAC name is 2-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-cyanoacetic acid.
| Compound Name | 2-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-cyanoacetic acid |
|---|---|
| PubChem CID | 146289561 |
| Molecular Formula | C9H4ClF3N2O2 |
| Molecular Weight | 264.59 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 2-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-cyanoacetic acid |
| SMILES | N#CC(C(=O)O)c1cc(C(F)(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C9H4ClF3N2O2/c10-7-2-4(9(11,12)13)1-6(15-7)5(3-14)8(16)17/h1-2,5H,(H,16,17) |
| InChIKey | XZSUAXVYAQWOQH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.59 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|