C18H28N2O2S — CID 146292818
1-[1-(4-methoxyphenyl)sulfinylpiperidin-4-yl]-3-methylpiperidine (PubChem CID 146292818) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is 1-[1-(4-methoxyphenyl)sulfinylpiperidin-4-yl]-3-methylpiperidine.
| Compound Name | 1-[1-(4-methoxyphenyl)sulfinylpiperidin-4-yl]-3-methylpiperidine |
|---|---|
| PubChem CID | 146292818 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 1-[1-(4-methoxyphenyl)sulfinylpiperidin-4-yl]-3-methylpiperidine |
| SMILES | COc1ccc(S(=O)N2CCC(N3CCCC(C)C3)CC2)cc1 |
| InChI | InChI=1S/C18H28N2O2S/c1-15-4-3-11-19(14-15)16-9-12-20(13-10-16)23(21)18-7-5-17(22-2)6-8-18/h5-8,15-16H,3-4,9-14H2,1-2H3 |
| InChIKey | OHAUNSJZHTVQCW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |