C16H16O4 — CID 146292918
7-hydroxy-3-[(2E,5E)-6-hydroxyhepta-2,5-dien-2-yl]chromen-4-one (PubChem CID 146292918) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 7-hydroxy-3-[(2E,5E)-6-hydroxyhepta-2,5-dien-2-yl]chromen-4-one.
| Compound Name | 7-hydroxy-3-[(2E,5E)-6-hydroxyhepta-2,5-dien-2-yl]chromen-4-one |
|---|---|
| PubChem CID | 146292918 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 7-hydroxy-3-[(2E,5E)-6-hydroxyhepta-2,5-dien-2-yl]chromen-4-one |
| SMILES | C/C(O)=C\C/C=C(\C)c1coc2cc(O)ccc2c1=O |
| InChI | InChI=1S/C16H16O4/c1-10(4-3-5-11(2)17)14-9-20-15-8-12(18)6-7-13(15)16(14)19/h4-9,17-18H,3H2,1-2H3/b10-4+,11-5+ |
| InChIKey | OOPXFBMPEDCOSV-ZVSIBQGLSA-N |
| XLogP | 3.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|