C11H17NO — CID 146293789
5-methyl-6-methylidene-3,4,5,7,8,9-hexahydro-2H-1,2-benzoxazepine (PubChem CID 146293789) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 5-methyl-6-methylidene-3,4,5,7,8,9-hexahydro-2H-1,2-benzoxazepine.
| Compound Name | 5-methyl-6-methylidene-3,4,5,7,8,9-hexahydro-2H-1,2-benzoxazepine |
|---|---|
| PubChem CID | 146293789 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 5-methyl-6-methylidene-3,4,5,7,8,9-hexahydro-2H-1,2-benzoxazepine |
| SMILES | C=C1CCCC2=C1C(C)CCNO2 |
| InChI | InChI=1S/C11H17NO/c1-8-4-3-5-10-11(8)9(2)6-7-12-13-10/h9,12H,1,3-7H2,2H3 |
| InChIKey | GKADZEDLCVUUQX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |