C19H20N6O3 — CID 146295205
benzyl N-[(E)-4-(2-amino-6-carbamoylimidazo[4,5-b]pyridin-3-yl)but-2-enyl]carbamate (PubChem CID 146295205) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is benzyl N-[(E)-4-(2-amino-6-carbamoylimidazo[4,5-b]pyridin-3-yl)but-2-enyl]carbamate.
| Compound Name | benzyl N-[(E)-4-(2-amino-6-carbamoylimidazo[4,5-b]pyridin-3-yl)but-2-enyl]carbamate |
|---|---|
| PubChem CID | 146295205 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | benzyl N-[(E)-4-(2-amino-6-carbamoylimidazo[4,5-b]pyridin-3-yl)but-2-enyl]carbamate |
| SMILES | NC(=O)c1cnc2c(c1)nc(N)n2C/C=C/CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H20N6O3/c20-16(26)14-10-15-17(23-11-14)25(18(21)24-15)9-5-4-8-22-19(27)28-12-13-6-2-1-3-7-13/h1-7,10-11H,8-9,12H2,(H2,20,26)(H2,21,24)(H,22,27)/b5-4+ |
| InChIKey | GCBGCQXDJDZRTJ-SNAWJCMRSA-N |
| XLogP | 1.60 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|