C10H11F3N4O2 — CID 146303367
[1-[2-(trifluoromethyl)pyrimidin-5-yl]pyrrolidin-3-yl] carbamate (PubChem CID 146303367) has the molecular formula C10H11F3N4O2 and a molecular weight of 276.22 g/mol. Its IUPAC name is [1-[2-(trifluoromethyl)pyrimidin-5-yl]pyrrolidin-3-yl] carbamate.
| Compound Name | [1-[2-(trifluoromethyl)pyrimidin-5-yl]pyrrolidin-3-yl] carbamate |
|---|---|
| PubChem CID | 146303367 |
| Molecular Formula | C10H11F3N4O2 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | [1-[2-(trifluoromethyl)pyrimidin-5-yl]pyrrolidin-3-yl] carbamate |
| SMILES | NC(=O)OC1CCN(c2cnc(C(F)(F)F)nc2)C1 |
| InChI | InChI=1S/C10H11F3N4O2/c11-10(12,13)8-15-3-6(4-16-8)17-2-1-7(5-17)19-9(14)18/h3-4,7H,1-2,5H2,(H2,14,18) |
| InChIKey | LGEDYEYEDMJFLZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |