1,4-dioxane;pyridine-3-carbonyl chloride

C10H12ClNO3 — CID 146303491

IUPAC1,4-dioxane;pyridine-3-carbonyl chloride
SMILESC1COCCO1.O=C(Cl)c1cccnc1
InChIInChI=1S/C6H4ClNO.C4H8O2/c7-6(9)5-2-1-3-8-4-5;1-2-6-4-3-5-1/h1-4H;1-4H2
InChIKeyKTJSMNDDFAZRPY-UHFFFAOYSA-N
MW229.66 g/mol
LogP1.49
Rot. Bonds1

About 1,4-dioxane;pyridine-3-carbonyl chloride

1,4-dioxane;pyridine-3-carbonyl chloride (PubChem CID 146303491) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is 1,4-dioxane;pyridine-3-carbonyl chloride.

Molecular Properties

Compound Name1,4-dioxane;pyridine-3-carbonyl chloride
PubChem CID146303491
Molecular FormulaC10H12ClNO3
Molecular Weight229.66 g/mol
Exact Mass229.05
IUPAC Name1,4-dioxane;pyridine-3-carbonyl chloride
SMILESC1COCCO1.O=C(Cl)c1cccnc1
InChIInChI=1S/C6H4ClNO.C4H8O2/c7-6(9)5-2-1-3-8-4-5;1-2-6-4-3-5-1/h1-4H;1-4H2
InChIKeyKTJSMNDDFAZRPY-UHFFFAOYSA-N
XLogP1.49
TPSA48.42 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.66
LogP ≤ 51.49
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1,4-dioxane;pyridine-3-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,4-dioxane;pyridine-3-carbonyl chloride?
The IUPAC name of 1,4-dioxane;pyridine-3-carbonyl chloride (CID 146303491) is 1,4-dioxane;pyridine-3-carbonyl chloride.
What is the SMILES notation for 1,4-dioxane;pyridine-3-carbonyl chloride?
The canonical SMILES for 1,4-dioxane;pyridine-3-carbonyl chloride is C1COCCO1.O=C(Cl)c1cccnc1.
What is the InChIKey of 1,4-dioxane;pyridine-3-carbonyl chloride?
The InChIKey is KTJSMNDDFAZRPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClNO.C4H8O2/c7-6(9)5-2-1-3-8-4-5;1-2-6-4-3-5-1/h1-4H;1-4H2.
What are the key properties of 1,4-dioxane;pyridine-3-carbonyl chloride?
1,4-dioxane;pyridine-3-carbonyl chloride has a molecular weight of 229.66 g/mol, XLogP of 1.49, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxane;pyridine-3-carbonyl chloride is sourced from PubChem (CID 146303491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).