About 1,4-dioxane;pyridine-3-carbonyl chloride
1,4-dioxane;pyridine-3-carbonyl chloride (PubChem CID 146303491) has the molecular formula C10H12ClNO3
and a molecular weight of 229.66 g/mol. Its IUPAC name is 1,4-dioxane;pyridine-3-carbonyl chloride.
Molecular Properties
| Compound Name | 1,4-dioxane;pyridine-3-carbonyl chloride |
| PubChem CID | 146303491 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 1,4-dioxane;pyridine-3-carbonyl chloride |
| SMILES | C1COCCO1.O=C(Cl)c1cccnc1 |
| InChI | InChI=1S/C6H4ClNO.C4H8O2/c7-6(9)5-2-1-3-8-4-5;1-2-6-4-3-5-1/h1-4H;1-4H2 |
| InChIKey | KTJSMNDDFAZRPY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dioxane;pyridine-3-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxane;pyridine-3-carbonyl chloride?
The IUPAC name of 1,4-dioxane;pyridine-3-carbonyl chloride (CID 146303491) is 1,4-dioxane;pyridine-3-carbonyl chloride.
What is the SMILES notation for 1,4-dioxane;pyridine-3-carbonyl chloride?
The canonical SMILES for 1,4-dioxane;pyridine-3-carbonyl chloride is C1COCCO1.O=C(Cl)c1cccnc1.
What is the InChIKey of 1,4-dioxane;pyridine-3-carbonyl chloride?
The InChIKey is KTJSMNDDFAZRPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClNO.C4H8O2/c7-6(9)5-2-1-3-8-4-5;1-2-6-4-3-5-1/h1-4H;1-4H2.
What are the key properties of 1,4-dioxane;pyridine-3-carbonyl chloride?
1,4-dioxane;pyridine-3-carbonyl chloride has a molecular weight of 229.66 g/mol, XLogP of 1.49, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxane;pyridine-3-carbonyl chloride is sourced from PubChem (CID 146303491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).