C18H20O6S — CID 146311232
methyl 3,4,5-trimethoxy-2-(2-methoxyphenyl)sulfanylbenzoate (PubChem CID 146311232) has the molecular formula C18H20O6S and a molecular weight of 364.42 g/mol. Its IUPAC name is methyl 3,4,5-trimethoxy-2-(2-methoxyphenyl)sulfanylbenzoate.
| Compound Name | methyl 3,4,5-trimethoxy-2-(2-methoxyphenyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 146311232 |
| Molecular Formula | C18H20O6S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | methyl 3,4,5-trimethoxy-2-(2-methoxyphenyl)sulfanylbenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)c(OC)c1Sc1ccccc1OC |
| InChI | InChI=1S/C18H20O6S/c1-20-12-8-6-7-9-14(12)25-17-11(18(19)24-5)10-13(21-2)15(22-3)16(17)23-4/h6-10H,1-5H3 |
| InChIKey | ZWLFKNRAKMOAEC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |