C16H14N2S — CID 146311466
3-methyl-1-phenyl-4,5-dihydrothieno[2,3-g]indazole (PubChem CID 146311466) has the molecular formula C16H14N2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 3-methyl-1-phenyl-4,5-dihydrothieno[2,3-g]indazole.
| Compound Name | 3-methyl-1-phenyl-4,5-dihydrothieno[2,3-g]indazole |
|---|---|
| PubChem CID | 146311466 |
| Molecular Formula | C16H14N2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-methyl-1-phenyl-4,5-dihydrothieno[2,3-g]indazole |
| SMILES | Cc1nn(-c2ccccc2)c2c1CCc1sccc1-2 |
| InChI | InChI=1S/C16H14N2S/c1-11-13-7-8-15-14(9-10-19-15)16(13)18(17-11)12-5-3-2-4-6-12/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | CNTWAVVBSYVAQF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |