C12H12N4O2 — CID 146315179
(2S)-2-amino-3-(3-cyano-1-methylindazol-5-yl)propanoic acid (PubChem CID 146315179) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is (2S)-2-amino-3-(3-cyano-1-methylindazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(3-cyano-1-methylindazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 146315179 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | (2S)-2-amino-3-(3-cyano-1-methylindazol-5-yl)propanoic acid |
| SMILES | Cn1nc(C#N)c2cc(C[C@H](N)C(=O)O)ccc21 |
| InChI | InChI=1S/C12H12N4O2/c1-16-11-3-2-7(5-9(14)12(17)18)4-8(11)10(6-13)15-16/h2-4,9H,5,14H2,1H3,(H,17,18)/t9-/m0/s1 |
| InChIKey | RFQSGYPAVSRVCT-VIFPVBQESA-N |
| XLogP | 0.40 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |