About 3-[3-(2,4-difluorophenyl)-2-(furan-2-yl)-2-hydroxypropyl]imidazole-4-carbonitrile
3-[3-(2,4-difluorophenyl)-2-(furan-2-yl)-2-hydroxypropyl]imidazole-4-carbonitrile (PubChem CID 146315734) has the molecular formula C17H13F2N3O2
and a molecular weight of 329.31 g/mol. Its IUPAC name is 3-[3-(2,4-difluorophenyl)-2-(furan-2-yl)-2-hydroxypropyl]imidazole-4-carbonitrile.
Molecular Properties
| Compound Name | 3-[3-(2,4-difluorophenyl)-2-(furan-2-yl)-2-hydroxypropyl]imidazole-4-carbonitrile |
| PubChem CID | 146315734 |
| Molecular Formula | C17H13F2N3O2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 3-[3-(2,4-difluorophenyl)-2-(furan-2-yl)-2-hydroxypropyl]imidazole-4-carbonitrile |
| SMILES | N#Cc1cncn1CC(O)(Cc1ccc(F)cc1F)c1ccco1 |
| InChI | InChI=1S/C17H13F2N3O2/c18-13-4-3-12(15(19)6-13)7-17(23,16-2-1-5-24-16)10-22-11-21-9-14(22)8-20/h1-6,9,11,23H,7,10H2 |
| InChIKey | SLKYNCZRCZISIU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 74.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[3-(2,4-difluorophenyl)-2-(furan-2-yl)-2-hydroxypropyl]imidazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2,4-difluorophenyl)-2-(furan-2-yl)-2-hydroxypropyl]imidazole-4-carbonitrile?
The IUPAC name of 3-[3-(2,4-difluorophenyl)-2-(furan-2-yl)-2-hydroxypropyl]imidazole-4-carbonitrile (CID 146315734) is 3-[3-(2,4-difluorophenyl)-2-(furan-2-yl)-2-hydroxypropyl]imidazole-4-carbonitrile.
What is the SMILES notation for 3-[3-(2,4-difluorophenyl)-2-(furan-2-yl)-2-hydroxypropyl]imidazole-4-carbonitrile?
The canonical SMILES for 3-[3-(2,4-difluorophenyl)-2-(furan-2-yl)-2-hydroxypropyl]imidazole-4-carbonitrile is N#Cc1cncn1CC(O)(Cc1ccc(F)cc1F)c1ccco1.
What is the InChIKey of 3-[3-(2,4-difluorophenyl)-2-(furan-2-yl)-2-hydroxypropyl]imidazole-4-carbonitrile?
The InChIKey is SLKYNCZRCZISIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F2N3O2/c18-13-4-3-12(15(19)6-13)7-17(23,16-2-1-5-24-16)10-22-11-21-9-14(22)8-20/h1-6,9,11,23H,7,10H2.
What are the key properties of 3-[3-(2,4-difluorophenyl)-2-(furan-2-yl)-2-hydroxypropyl]imidazole-4-carbonitrile?
3-[3-(2,4-difluorophenyl)-2-(furan-2-yl)-2-hydroxypropyl]imidazole-4-carbonitrile has a molecular weight of 329.31 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2,4-difluorophenyl)-2-(furan-2-yl)-2-hydroxypropyl]imidazole-4-carbonitrile is sourced from PubChem (CID 146315734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).