C16H25NO — CID 146318276
(7Z)-2,9,9-trimethyl-6-methylidene-8-(methyliminomethyl)deca-2,7-dien-4-one (PubChem CID 146318276) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (7Z)-2,9,9-trimethyl-6-methylidene-8-(methyliminomethyl)deca-2,7-dien-4-one.
| Compound Name | (7Z)-2,9,9-trimethyl-6-methylidene-8-(methyliminomethyl)deca-2,7-dien-4-one |
|---|---|
| PubChem CID | 146318276 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (7Z)-2,9,9-trimethyl-6-methylidene-8-(methyliminomethyl)deca-2,7-dien-4-one |
| SMILES | C=C(/C=C(\C=N\C)C(C)(C)C)CC(=O)C=C(C)C |
| InChI | InChI=1S/C16H25NO/c1-12(2)8-15(18)10-13(3)9-14(11-17-7)16(4,5)6/h8-9,11H,3,10H2,1-2,4-7H3/b14-9+,17-11+ |
| InChIKey | XEQJQRZGIRRUKI-UHECJYLPSA-N |
| XLogP | 4.14 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|