About ethyl 3-oxobutanoate;4-ethyl-3-oxohexanamide
ethyl 3-oxobutanoate;4-ethyl-3-oxohexanamide (PubChem CID 146318641) has the molecular formula C14H25NO5
and a molecular weight of 287.36 g/mol. Its IUPAC name is ethyl 3-oxobutanoate;4-ethyl-3-oxohexanamide.
Molecular Properties
| Compound Name | ethyl 3-oxobutanoate;4-ethyl-3-oxohexanamide |
| PubChem CID | 146318641 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | ethyl 3-oxobutanoate;4-ethyl-3-oxohexanamide |
| SMILES | CCC(CC)C(=O)CC(N)=O.CCOC(=O)CC(C)=O |
| InChI | InChI=1S/C8H15NO2.C6H10O3/c1-3-6(4-2)7(10)5-8(9)11;1-3-9-6(8)4-5(2)7/h6H,3-5H2,1-2H3,(H2,9,11);3-4H2,1-2H3 |
| InChIKey | XBUSPKUYAKZZGD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-oxobutanoate;4-ethyl-3-oxohexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-oxobutanoate;4-ethyl-3-oxohexanamide?
The IUPAC name of ethyl 3-oxobutanoate;4-ethyl-3-oxohexanamide (CID 146318641) is ethyl 3-oxobutanoate;4-ethyl-3-oxohexanamide.
What is the SMILES notation for ethyl 3-oxobutanoate;4-ethyl-3-oxohexanamide?
The canonical SMILES for ethyl 3-oxobutanoate;4-ethyl-3-oxohexanamide is CCC(CC)C(=O)CC(N)=O.CCOC(=O)CC(C)=O.
What is the InChIKey of ethyl 3-oxobutanoate;4-ethyl-3-oxohexanamide?
The InChIKey is XBUSPKUYAKZZGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C6H10O3/c1-3-6(4-2)7(10)5-8(9)11;1-3-9-6(8)4-5(2)7/h6H,3-5H2,1-2H3,(H2,9,11);3-4H2,1-2H3.
What are the key properties of ethyl 3-oxobutanoate;4-ethyl-3-oxohexanamide?
ethyl 3-oxobutanoate;4-ethyl-3-oxohexanamide has a molecular weight of 287.36 g/mol, XLogP of 1.40, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-oxobutanoate;4-ethyl-3-oxohexanamide is sourced from PubChem (CID 146318641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).