C16H20S2 — CID 146324274
2-(3,3-dimethyl-1-thiophen-2-ylhex-1-enyl)thiophene (PubChem CID 146324274) has the molecular formula C16H20S2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 2-(3,3-dimethyl-1-thiophen-2-ylhex-1-enyl)thiophene.
| Compound Name | 2-(3,3-dimethyl-1-thiophen-2-ylhex-1-enyl)thiophene |
|---|---|
| PubChem CID | 146324274 |
| Molecular Formula | C16H20S2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-(3,3-dimethyl-1-thiophen-2-ylhex-1-enyl)thiophene |
| SMILES | CCCC(C)(C)C=C(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C16H20S2/c1-4-9-16(2,3)12-13(14-7-5-10-17-14)15-8-6-11-18-15/h5-8,10-12H,4,9H2,1-3H3 |
| InChIKey | VRQBEZPFGMDPCR-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |