C29H52N4O3S — CID 146327129
1-[1-[1-tert-butyl-9-(2,2-dimethylpropoxy)-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d]triazol-6-yl]-2-methylpropan-2-yl]-3-tert-butylsulfanylpyrrolidine-2,5-dione (PubChem CID 146327129) has the molecular formula C29H52N4O3S and a molecular weight of 536.83 g/mol. Its IUPAC name is 1-[1-[1-tert-butyl-9-(2,2-dimethylpropoxy)-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d]triazol-6-yl]-2-methylpropan-2-yl]-3-tert-butylsulfanylpyrrolidine-2,5-dione.
| Compound Name | 1-[1-[1-tert-butyl-9-(2,2-dimethylpropoxy)-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d]triazol-6-yl]-2-methylpropan-2-yl]-3-tert-butylsulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 146327129 |
| Molecular Formula | C29H52N4O3S |
| Molecular Weight | 536.83 g/mol |
| Exact Mass | 536.38 |
| IUPAC Name | 1-[1-[1-tert-butyl-9-(2,2-dimethylpropoxy)-3a,4,5,6,7,8,9,9a-octahydrocycloocta[d]triazol-6-yl]-2-methylpropan-2-yl]-3-tert-butylsulfanylpyrrolidine-2,5-dione |
| SMILES | CC(C)(C)COC1CCC(CC(C)(C)N2C(=O)CC(SC(C)(C)C)C2=O)CCC2N=NN(C(C)(C)C)C21 |
| InChI | InChI=1S/C29H52N4O3S/c1-26(2,3)18-36-21-15-13-19(12-14-20-24(21)33(31-30-20)27(4,5)6)17-29(10,11)32-23(34)16-22(25(32)35)37-28(7,8)9/h19-22,24H,12-18H2,1-11H3 |
| InChIKey | QLCMSCJNOZVSKU-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.83 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|