C19H19N7O2 — CID 146327370
3-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-1-ethylpyridin-2-one (PubChem CID 146327370) has the molecular formula C19H19N7O2 and a molecular weight of 377.41 g/mol. Its IUPAC name is 3-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-1-ethylpyridin-2-one.
| Compound Name | 3-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-1-ethylpyridin-2-one |
|---|---|
| PubChem CID | 146327370 |
| Molecular Formula | C19H19N7O2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 3-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-1-ethylpyridin-2-one |
| SMILES | CCn1cccc(Cn2cc(-c3nc(N)nc4c(OC)cccc34)nn2)c1=O |
| InChI | InChI=1S/C19H19N7O2/c1-3-25-9-5-6-12(18(25)27)10-26-11-14(23-24-26)16-13-7-4-8-15(28-2)17(13)22-19(20)21-16/h4-9,11H,3,10H2,1-2H3,(H2,20,21,22) |
| InChIKey | ZNIJLCUNOANHMA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |