C22H26N7O2+ — CID 159766753
4-[1-[[1-hydroxy-6-(2-methylbutan-2-yl)pyridin-1-ium-2-yl]methyl]triazol-4-yl]-8-methoxyquinazolin-2-amine (PubChem CID 159766753) has the molecular formula C22H26N7O2+ and a molecular weight of 420.50 g/mol. Its IUPAC name is 4-[1-[[1-hydroxy-6-(2-methylbutan-2-yl)pyridin-1-ium-2-yl]methyl]triazol-4-yl]-8-methoxyquinazolin-2-amine.
| Compound Name | 4-[1-[[1-hydroxy-6-(2-methylbutan-2-yl)pyridin-1-ium-2-yl]methyl]triazol-4-yl]-8-methoxyquinazolin-2-amine |
|---|---|
| PubChem CID | 159766753 |
| Molecular Formula | C22H26N7O2+ |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 4-[1-[[1-hydroxy-6-(2-methylbutan-2-yl)pyridin-1-ium-2-yl]methyl]triazol-4-yl]-8-methoxyquinazolin-2-amine |
| SMILES | CCC(C)(C)c1cccc(Cn2cc(-c3nc(N)nc4c(OC)cccc34)nn2)[n+]1O |
| InChI | InChI=1S/C22H26N7O2/c1-5-22(2,3)18-11-6-8-14(29(18)30)12-28-13-16(26-27-28)19-15-9-7-10-17(31-4)20(15)25-21(23)24-19/h6-11,13,30H,5,12H2,1-4H3,(H2,23,24,25)/q+1 |
| InChIKey | NFPHNXXRNLSOIS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|