C20H21FN7O3+ — CID 146436662
2-[6-[[4-(2-amino-7-fluoro-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-1-hydroxypyridin-1-ium-2-yl]propan-2-ol (PubChem CID 146436662) has the molecular formula C20H21FN7O3+ and a molecular weight of 426.43 g/mol. Its IUPAC name is 2-[6-[[4-(2-amino-7-fluoro-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-1-hydroxypyridin-1-ium-2-yl]propan-2-ol.
| Compound Name | 2-[6-[[4-(2-amino-7-fluoro-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-1-hydroxypyridin-1-ium-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 146436662 |
| Molecular Formula | C20H21FN7O3+ |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-[6-[[4-(2-amino-7-fluoro-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-1-hydroxypyridin-1-ium-2-yl]propan-2-ol |
| SMILES | COc1c(F)ccc2c(-c3cn(Cc4cccc(C(C)(C)O)[n+]4O)nn3)nc(N)nc12 |
| InChI | InChI=1S/C20H21FN7O3/c1-20(2,29)15-6-4-5-11(28(15)30)9-27-10-14(25-26-27)16-12-7-8-13(21)18(31-3)17(12)24-19(22)23-16/h4-8,10,29-30H,9H2,1-3H3,(H2,22,23,24)/q+1 |
| InChIKey | QDYMBLDJLPCSKU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|