C21H19F3N7O4+ — CID 169085458
2-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-6-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]pyridin-1-ium-1-carboxylic acid (PubChem CID 169085458) has the molecular formula C21H19F3N7O4+ and a molecular weight of 490.42 g/mol. Its IUPAC name is 2-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-6-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]pyridin-1-ium-1-carboxylic acid.
| Compound Name | 2-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-6-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]pyridin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 169085458 |
| Molecular Formula | C21H19F3N7O4+ |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 2-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-6-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]pyridin-1-ium-1-carboxylic acid |
| SMILES | COc1cccc2c(-c3cn(Cc4cccc([C@](C)(O)C(F)(F)F)[n+]4C(=O)O)nn3)nc(N)nc12 |
| InChI | InChI=1S/C21H18F3N7O4/c1-20(34,21(22,23)24)15-8-3-5-11(31(15)19(32)33)9-30-10-13(28-29-30)16-12-6-4-7-14(35-2)17(12)27-18(25)26-16/h3-8,10,34H,9H2,1-2H3,(H2-,25,26,27,32,33)/p+1/t20-/m0/s1 |
| InChIKey | SRIRSDHCWPECOQ-FQEVSTJZSA-O |
| XLogP | 2.11 |
| TPSA | 153.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|