C21H18F3N7O4 — CID 175404091
2-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-6-(1,1,3-trifluoro-2-hydroxypropan-2-yl)pyridin-1-ium-1-carboxylate (PubChem CID 175404091) has the molecular formula C21H18F3N7O4 and a molecular weight of 489.41 g/mol. Its IUPAC name is 2-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-6-(1,1,3-trifluoro-2-hydroxypropan-2-yl)pyridin-1-ium-1-carboxylate.
| Compound Name | 2-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-6-(1,1,3-trifluoro-2-hydroxypropan-2-yl)pyridin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 175404091 |
| Molecular Formula | C21H18F3N7O4 |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 2-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-6-(1,1,3-trifluoro-2-hydroxypropan-2-yl)pyridin-1-ium-1-carboxylate |
| SMILES | COc1cccc2c(-c3cn(Cc4cccc(C(O)(CF)C(F)F)[n+]4C(=O)[O-])nn3)nc(N)nc12 |
| InChI | InChI=1S/C21H18F3N7O4/c1-35-14-6-3-5-12-16(26-19(25)27-17(12)14)13-9-30(29-28-13)8-11-4-2-7-15(31(11)20(32)33)21(34,10-22)18(23)24/h2-7,9,18,34H,8,10H2,1H3,(H2-,25,26,27,32,33) |
| InChIKey | GRQNTLWMPYLBAO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 155.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|