C20H18F3N7O3 — CID 146423025
(2S)-2-[6-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-1-oxidopyridin-1-ium-2-yl]-1,1,1-trifluoropropan-2-ol (PubChem CID 146423025) has the molecular formula C20H18F3N7O3 and a molecular weight of 461.40 g/mol. Its IUPAC name is (2S)-2-[6-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-1-oxidopyridin-1-ium-2-yl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-2-[6-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-1-oxidopyridin-1-ium-2-yl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 146423025 |
| Molecular Formula | C20H18F3N7O3 |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | (2S)-2-[6-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-1-oxidopyridin-1-ium-2-yl]-1,1,1-trifluoropropan-2-ol |
| SMILES | COc1cccc2c(-c3cn(Cc4cccc([C@](C)(O)C(F)(F)F)[n+]4[O-])nn3)nc(N)nc12 |
| InChI | InChI=1S/C20H18F3N7O3/c1-19(31,20(21,22)23)15-8-3-5-11(30(15)32)9-29-10-13(27-28-29)16-12-6-4-7-14(33-2)17(12)26-18(24)25-16/h3-8,10,31H,9H2,1-2H3,(H2,24,25,26)/t19-/m0/s1 |
| InChIKey | JFXDMEOJXUXNLH-IBGZPJMESA-N |
| XLogP | 1.93 |
| TPSA | 138.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|