C23H27N7O3 — CID 146327493
(2Z,4Z)-2-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-5-[1-(1-hydroxycyclopropyl)ethyl-methylamino]penta-2,4-dienal (PubChem CID 146327493) has the molecular formula C23H27N7O3 and a molecular weight of 449.52 g/mol. Its IUPAC name is (2Z,4Z)-2-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-5-[1-(1-hydroxycyclopropyl)ethyl-methylamino]penta-2,4-dienal.
| Compound Name | (2Z,4Z)-2-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-5-[1-(1-hydroxycyclopropyl)ethyl-methylamino]penta-2,4-dienal |
|---|---|
| PubChem CID | 146327493 |
| Molecular Formula | C23H27N7O3 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (2Z,4Z)-2-[[4-(2-amino-8-methoxyquinazolin-4-yl)triazol-1-yl]methyl]-5-[1-(1-hydroxycyclopropyl)ethyl-methylamino]penta-2,4-dienal |
| SMILES | COc1cccc2c(-c3cn(C/C(C=O)=C/C=C\N(C)C(C)C4(O)CC4)nn3)nc(N)nc12 |
| InChI | InChI=1S/C23H27N7O3/c1-15(23(32)9-10-23)29(2)11-5-6-16(14-31)12-30-13-18(27-28-30)20-17-7-4-8-19(33-3)21(17)26-22(24)25-20/h4-8,11,13-15,32H,9-10,12H2,1-3H3,(H2,24,25,26)/b11-5-,16-6- |
| InChIKey | UDFNXLNACYZIBB-SZAYPXIASA-N |
| XLogP | 1.96 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|