C27H36N6O2 — CID 146327687
2-amino-8-N-[(E)-1-[4-(methylideneamino)-1,2,3,6-tetrahydropyridin-5-yl]prop-1-en-2-yl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide (PubChem CID 146327687) has the molecular formula C27H36N6O2 and a molecular weight of 476.63 g/mol. Its IUPAC name is 2-amino-8-N-[(E)-1-[4-(methylideneamino)-1,2,3,6-tetrahydropyridin-5-yl]prop-1-en-2-yl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide.
| Compound Name | 2-amino-8-N-[(E)-1-[4-(methylideneamino)-1,2,3,6-tetrahydropyridin-5-yl]prop-1-en-2-yl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide |
|---|---|
| PubChem CID | 146327687 |
| Molecular Formula | C27H36N6O2 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 2-amino-8-N-[(E)-1-[4-(methylideneamino)-1,2,3,6-tetrahydropyridin-5-yl]prop-1-en-2-yl]-4-N,4-N-dipropyl-3H-1-benzazepine-4,8-dicarboxamide |
| SMILES | C=NC1=C(/C=C(\C)NC(=O)c2ccc3c(c2)N=C(N)CC(C(=O)N(CCC)CCC)=C3)CNCC1 |
| InChI | InChI=1S/C27H36N6O2/c1-5-11-33(12-6-2)27(35)21-14-19-7-8-20(15-24(19)32-25(28)16-21)26(34)31-18(3)13-22-17-30-10-9-23(22)29-4/h7-8,13-15,30H,4-6,9-12,16-17H2,1-3H3,(H2,28,32)(H,31,34)/b18-13+ |
| InChIKey | AGKDNHYEFSTICP-QGOAFFKASA-N |
| XLogP | 3.69 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|