C9H15Cl — CID 146332316
(3E)-3-(chloromethyl)-2,4-dimethylhexa-1,3-diene (PubChem CID 146332316) has the molecular formula C9H15Cl and a molecular weight of 158.67 g/mol. Its IUPAC name is (3E)-3-(chloromethyl)-2,4-dimethylhexa-1,3-diene.
| Compound Name | (3E)-3-(chloromethyl)-2,4-dimethylhexa-1,3-diene |
|---|---|
| PubChem CID | 146332316 |
| Molecular Formula | C9H15Cl |
| Molecular Weight | 158.67 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (3E)-3-(chloromethyl)-2,4-dimethylhexa-1,3-diene |
| SMILES | C=C(C)/C(CCl)=C(/C)CC |
| InChI | InChI=1S/C9H15Cl/c1-5-8(4)9(6-10)7(2)3/h2,5-6H2,1,3-4H3/b9-8- |
| InChIKey | IDJFJARMUBCFKH-HJWRWDBZSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.67 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|