C14H23N — CID 143544186
(4E)-N-ethenyl-2,5-dimethyl-4-propylhepta-1,4-dien-3-imine (PubChem CID 143544186) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (4E)-N-ethenyl-2,5-dimethyl-4-propylhepta-1,4-dien-3-imine.
| Compound Name | (4E)-N-ethenyl-2,5-dimethyl-4-propylhepta-1,4-dien-3-imine |
|---|---|
| PubChem CID | 143544186 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (4E)-N-ethenyl-2,5-dimethyl-4-propylhepta-1,4-dien-3-imine |
| SMILES | C=C/N=C(C(=C)C)/C(CCC)=C(\C)CC |
| InChI | InChI=1S/C14H23N/c1-7-10-13(12(6)8-2)14(11(4)5)15-9-3/h9H,3-4,7-8,10H2,1-2,5-6H3/b13-12+,15-14+ |
| InChIKey | JPXQLDHHHUKKIZ-SQIWNDBBSA-N |
| XLogP | 4.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|