C24H16N2O2 — CID 146334082
1,9-diphenylpyrido[3,2-g]quinoline-4,6-dione (PubChem CID 146334082) has the molecular formula C24H16N2O2 and a molecular weight of 364.40 g/mol. Its IUPAC name is 1,9-diphenylpyrido[3,2-g]quinoline-4,6-dione.
| Compound Name | 1,9-diphenylpyrido[3,2-g]quinoline-4,6-dione |
|---|---|
| PubChem CID | 146334082 |
| Molecular Formula | C24H16N2O2 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1,9-diphenylpyrido[3,2-g]quinoline-4,6-dione |
| SMILES | O=c1ccn(-c2ccccc2)c2cc3c(cc12)c(=O)ccn3-c1ccccc1 |
| InChI | InChI=1S/C24H16N2O2/c27-23-11-13-25(17-7-3-1-4-8-17)21-16-22-20(15-19(21)23)24(28)12-14-26(22)18-9-5-2-6-10-18/h1-16H |
| InChIKey | SBKMCEIUMMYQOZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|