C34H28N2O4 — CID 146335577
7-[4-[(1,4-dioxonaphthalen-2-yl)amino]-2-methylbutyl]-2-(3-phenylprop-2-ynylamino)naphthalene-1,4-dione (PubChem CID 146335577) has the molecular formula C34H28N2O4 and a molecular weight of 528.61 g/mol. Its IUPAC name is 7-[4-[(1,4-dioxonaphthalen-2-yl)amino]-2-methylbutyl]-2-(3-phenylprop-2-ynylamino)naphthalene-1,4-dione.
| Compound Name | 7-[4-[(1,4-dioxonaphthalen-2-yl)amino]-2-methylbutyl]-2-(3-phenylprop-2-ynylamino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 146335577 |
| Molecular Formula | C34H28N2O4 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 7-[4-[(1,4-dioxonaphthalen-2-yl)amino]-2-methylbutyl]-2-(3-phenylprop-2-ynylamino)naphthalene-1,4-dione |
| SMILES | CC(CCNC1=CC(=O)c2ccccc2C1=O)Cc1ccc2c(c1)C(=O)C(NCC#Cc1ccccc1)=CC2=O |
| InChI | InChI=1S/C34H28N2O4/c1-22(15-17-36-29-20-31(37)25-11-5-6-12-27(25)33(29)39)18-24-13-14-26-28(19-24)34(40)30(21-32(26)38)35-16-7-10-23-8-3-2-4-9-23/h2-6,8-9,11-14,19-22,35-36H,15-18H2,1H3 |
| InChIKey | FDRNXWVMKDJJKU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|