C18H23NO2 — CID 86035639
2-(ethylamino)-7-(4-methylpentyl)naphthalene-1,4-dione (PubChem CID 86035639) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-(ethylamino)-7-(4-methylpentyl)naphthalene-1,4-dione.
| Compound Name | 2-(ethylamino)-7-(4-methylpentyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 86035639 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-(ethylamino)-7-(4-methylpentyl)naphthalene-1,4-dione |
| SMILES | CCNC1=CC(=O)c2ccc(CCCC(C)C)cc2C1=O |
| InChI | InChI=1S/C18H23NO2/c1-4-19-16-11-17(20)14-9-8-13(7-5-6-12(2)3)10-15(14)18(16)21/h8-12,19H,4-7H2,1-3H3 |
| InChIKey | BHUJJFAHXVXRBW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|