C20H22O3 — CID 71423033
2-ethyl-7-(4-methylpentyl)benzo[f][1]benzofuran-4,9-dione (PubChem CID 71423033) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-ethyl-7-(4-methylpentyl)benzo[f][1]benzofuran-4,9-dione.
| Compound Name | 2-ethyl-7-(4-methylpentyl)benzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 71423033 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 2-ethyl-7-(4-methylpentyl)benzo[f][1]benzofuran-4,9-dione |
| SMILES | CCc1cc2c(o1)C(=O)c1cc(CCCC(C)C)ccc1C2=O |
| InChI | InChI=1S/C20H22O3/c1-4-14-11-17-18(21)15-9-8-13(7-5-6-12(2)3)10-16(15)19(22)20(17)23-14/h8-12H,4-7H2,1-3H3 |
| InChIKey | CATUHVYNQAQTTH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|