C27H34O2 — CID 134293365
2,7-bis(4-methylpentyl)-8H-cyclohepta[b]naphthalene-5,11-dione (PubChem CID 134293365) has the molecular formula C27H34O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is 2,7-bis(4-methylpentyl)-8H-cyclohepta[b]naphthalene-5,11-dione.
| Compound Name | 2,7-bis(4-methylpentyl)-8H-cyclohepta[b]naphthalene-5,11-dione |
|---|---|
| PubChem CID | 134293365 |
| Molecular Formula | C27H34O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | 2,7-bis(4-methylpentyl)-8H-cyclohepta[b]naphthalene-5,11-dione |
| SMILES | CC(C)CCCC1=CC2=C(C=CC1)C(=O)c1cc(CCCC(C)C)ccc1C2=O |
| InChI | InChI=1S/C27H34O2/c1-18(2)8-5-10-20-12-7-13-22-24(16-20)27(29)23-15-14-21(11-6-9-19(3)4)17-25(23)26(22)28/h7,13-19H,5-6,8-12H2,1-4H3 |
| InChIKey | ZLZXNHSAGFVUBZ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|