C16H15NO3 — CID 146335409
2-(1-hydroxyhex-4-yn-2-ylamino)naphthalene-1,4-dione (PubChem CID 146335409) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(1-hydroxyhex-4-yn-2-ylamino)naphthalene-1,4-dione.
| Compound Name | 2-(1-hydroxyhex-4-yn-2-ylamino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 146335409 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-(1-hydroxyhex-4-yn-2-ylamino)naphthalene-1,4-dione |
| SMILES | CC#CCC(CO)NC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H15NO3/c1-2-3-6-11(10-18)17-14-9-15(19)12-7-4-5-8-13(12)16(14)20/h4-5,7-9,11,17-18H,6,10H2,1H3 |
| InChIKey | VGZUMFUTWDHLTD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|