C19H29NO9S — CID 146336193
[4-[2-ethoxy-2-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] 3-methoxysulfonylpropanoate (PubChem CID 146336193) has the molecular formula C19H29NO9S and a molecular weight of 447.51 g/mol. Its IUPAC name is [4-[2-ethoxy-2-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] 3-methoxysulfonylpropanoate.
| Compound Name | [4-[2-ethoxy-2-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] 3-methoxysulfonylpropanoate |
|---|---|
| PubChem CID | 146336193 |
| Molecular Formula | C19H29NO9S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | [4-[2-ethoxy-2-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] 3-methoxysulfonylpropanoate |
| SMILES | CCOC(O)C(NC(=O)OC(C)(C)C)c1ccc(OC(=O)CCS(=O)(=O)OC)cc1 |
| InChI | InChI=1S/C19H29NO9S/c1-6-27-17(22)16(20-18(23)29-19(2,3)4)13-7-9-14(10-8-13)28-15(21)11-12-30(24,25)26-5/h7-10,16-17,22H,6,11-12H2,1-5H3,(H,20,23) |
| InChIKey | FPJZADBDLFHGSO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|