C20H35NO3S2 — CID 146336649
3-[5-(dithiolan-3-yl)decanoylamino]propyl 2-methylprop-2-enoate (PubChem CID 146336649) has the molecular formula C20H35NO3S2 and a molecular weight of 401.64 g/mol. Its IUPAC name is 3-[5-(dithiolan-3-yl)decanoylamino]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[5-(dithiolan-3-yl)decanoylamino]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146336649 |
| Molecular Formula | C20H35NO3S2 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 3-[5-(dithiolan-3-yl)decanoylamino]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCNC(=O)CCCC(CCCCC)C1CCSS1 |
| InChI | InChI=1S/C20H35NO3S2/c1-4-5-6-9-17(18-12-15-25-26-18)10-7-11-19(22)21-13-8-14-24-20(23)16(2)3/h17-18H,2,4-15H2,1,3H3,(H,21,22) |
| InChIKey | PLPNXWFLZSZMHN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|